C18H29N3S — CID 166072667
(E)-1-N'-[(E)-1-(4-heptylsulfanylphenyl)ethylideneamino]prop-1-ene-1,1-diamine (PubChem CID 166072667) has the molecular formula C18H29N3S and a molecular weight of 319.52 g/mol. Its IUPAC name is (E)-1-N'-[(E)-1-(4-heptylsulfanylphenyl)ethylideneamino]prop-1-ene-1,1-diamine.
| Compound Name | (E)-1-N'-[(E)-1-(4-heptylsulfanylphenyl)ethylideneamino]prop-1-ene-1,1-diamine |
|---|---|
| PubChem CID | 166072667 |
| Molecular Formula | C18H29N3S |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | (E)-1-N'-[(E)-1-(4-heptylsulfanylphenyl)ethylideneamino]prop-1-ene-1,1-diamine |
| SMILES | C/C=C(\N)N/N=C(\C)c1ccc(SCCCCCCC)cc1 |
| InChI | InChI=1S/C18H29N3S/c1-4-6-7-8-9-14-22-17-12-10-16(11-13-17)15(3)20-21-18(19)5-2/h5,10-13,21H,4,6-9,14,19H2,1-3H3/b18-5+,20-15+ |
| InChIKey | ATHKQTLNSHPSMV-ZVIAHPAUSA-N |
| XLogP | 4.88 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|