C23H34BrN3S2 — CID 22675673
1,2-bis(4-pentylsulfanylphenyl)guanidine;hydrobromide (PubChem CID 22675673) has the molecular formula C23H34BrN3S2 and a molecular weight of 496.58 g/mol. Its IUPAC name is 1,2-bis(4-pentylsulfanylphenyl)guanidine;hydrobromide.
| Compound Name | 1,2-bis(4-pentylsulfanylphenyl)guanidine;hydrobromide |
|---|---|
| PubChem CID | 22675673 |
| Molecular Formula | C23H34BrN3S2 |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 1,2-bis(4-pentylsulfanylphenyl)guanidine;hydrobromide |
| SMILES | Br.CCCCCSc1ccc(/N=C(\N)Nc2ccc(SCCCCC)cc2)cc1 |
| InChI | InChI=1S/C23H33N3S2.BrH/c1-3-5-7-17-27-21-13-9-19(10-14-21)25-23(24)26-20-11-15-22(16-12-20)28-18-8-6-4-2;/h9-16H,3-8,17-18H2,1-2H3,(H3,24,25,26);1H |
| InChIKey | DQDSTZSYWZIDFB-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|