C19H17F3N2O3S — CID 166073849
N-[2-methoxy-5-[4-(trifluoromethyl)phenoxy]phenyl]-5-sulfanylidenepyrrolidine-2-carboxamide (PubChem CID 166073849) has the molecular formula C19H17F3N2O3S and a molecular weight of 410.42 g/mol. Its IUPAC name is N-[2-methoxy-5-[4-(trifluoromethyl)phenoxy]phenyl]-5-sulfanylidenepyrrolidine-2-carboxamide.
| Compound Name | N-[2-methoxy-5-[4-(trifluoromethyl)phenoxy]phenyl]-5-sulfanylidenepyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166073849 |
| Molecular Formula | C19H17F3N2O3S |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | N-[2-methoxy-5-[4-(trifluoromethyl)phenoxy]phenyl]-5-sulfanylidenepyrrolidine-2-carboxamide |
| SMILES | COc1ccc(Oc2ccc(C(F)(F)F)cc2)cc1NC(=O)C1CCC(=S)N1 |
| InChI | InChI=1S/C19H17F3N2O3S/c1-26-16-8-6-13(27-12-4-2-11(3-5-12)19(20,21)22)10-15(16)24-18(25)14-7-9-17(28)23-14/h2-6,8,10,14H,7,9H2,1H3,(H,23,28)(H,24,25) |
| InChIKey | NHLARUIRQRQUFR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|