C11H24N2O — CID 166075465
N-[4-(dimethylamino)-2,3-dimethylbutyl]propanamide (PubChem CID 166075465) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is N-[4-(dimethylamino)-2,3-dimethylbutyl]propanamide.
| Compound Name | N-[4-(dimethylamino)-2,3-dimethylbutyl]propanamide |
|---|---|
| PubChem CID | 166075465 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | N-[4-(dimethylamino)-2,3-dimethylbutyl]propanamide |
| SMILES | CCC(=O)NCC(C)C(C)CN(C)C |
| InChI | InChI=1S/C11H24N2O/c1-6-11(14)12-7-9(2)10(3)8-13(4)5/h9-10H,6-8H2,1-5H3,(H,12,14) |
| InChIKey | HEWOXNRIAVVWLV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |