About ethane;1-methoxypropane;1-methylpiperidine-4-carboxamide
ethane;1-methoxypropane;1-methylpiperidine-4-carboxamide (PubChem CID 166075816) has the molecular formula C13H30N2O2
and a molecular weight of 246.39 g/mol. Its IUPAC name is ethane;1-methoxypropane;1-methylpiperidine-4-carboxamide.
Molecular Properties
| Compound Name | ethane;1-methoxypropane;1-methylpiperidine-4-carboxamide |
| PubChem CID | 166075816 |
| Molecular Formula | C13H30N2O2 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | ethane;1-methoxypropane;1-methylpiperidine-4-carboxamide |
| SMILES | CC.CCCOC.CN1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C7H14N2O.C4H10O.C2H6/c1-9-4-2-6(3-5-9)7(8)10;1-3-4-5-2;1-2/h6H,2-5H2,1H3,(H2,8,10);3-4H2,1-2H3;1-2H3 |
| InChIKey | VKBQLVKSCUQPDY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1-methoxypropane;1-methylpiperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methoxypropane;1-methylpiperidine-4-carboxamide?
The IUPAC name of ethane;1-methoxypropane;1-methylpiperidine-4-carboxamide (CID 166075816) is ethane;1-methoxypropane;1-methylpiperidine-4-carboxamide.
What is the SMILES notation for ethane;1-methoxypropane;1-methylpiperidine-4-carboxamide?
The canonical SMILES for ethane;1-methoxypropane;1-methylpiperidine-4-carboxamide is CC.CCCOC.CN1CCC(C(N)=O)CC1.
What is the InChIKey of ethane;1-methoxypropane;1-methylpiperidine-4-carboxamide?
The InChIKey is VKBQLVKSCUQPDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O.C4H10O.C2H6/c1-9-4-2-6(3-5-9)7(8)10;1-3-4-5-2;1-2/h6H,2-5H2,1H3,(H2,8,10);3-4H2,1-2H3;1-2H3.
What are the key properties of ethane;1-methoxypropane;1-methylpiperidine-4-carboxamide?
ethane;1-methoxypropane;1-methylpiperidine-4-carboxamide has a molecular weight of 246.39 g/mol, XLogP of 1.88, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methoxypropane;1-methylpiperidine-4-carboxamide is sourced from PubChem (CID 166075816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).