C25H20B2ClFN4O3 — CID 166076412
CID 166076412 (PubChem CID 166076412) has the molecular formula C25H20B2ClFN4O3 and a molecular weight of 500.54 g/mol.
| Compound Name | CID 166076412 |
|---|---|
| PubChem CID | 166076412 |
| Molecular Formula | C25H20B2ClFN4O3 |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | — |
| SMILES | [B]C1([B])c2ncccc2C(=O)N1Cc1c(F)cc(-c2ccc(OCCOC)c3nn(C)cc23)cc1Cl |
| InChI | InChI=1S/C25H20B2ClFN4O3/c1-32-12-17-15(5-6-21(22(17)31-32)36-9-8-35-2)14-10-19(28)18(20(29)11-14)13-33-24(34)16-4-3-7-30-23(16)25(33,26)27/h3-7,10-12H,8-9,13H2,1-2H3 |
| InChIKey | ZRDZRBPVTDZZEL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|