C23H14B2F4N4O2 — CID 166076832
CID 166076832 (PubChem CID 166076832) has the molecular formula C23H14B2F4N4O2 and a molecular weight of 476.01 g/mol.
| Compound Name | CID 166076832 |
|---|---|
| PubChem CID | 166076832 |
| Molecular Formula | C23H14B2F4N4O2 |
| Molecular Weight | 476.01 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | — |
| SMILES | [B]C1([B])c2ncccc2C(=O)N1Cc1c(F)cc(-c2ccc(OC(F)F)c3nn(C)cc23)cc1F |
| InChI | InChI=1S/C23H14B2F4N4O2/c1-32-9-14-12(4-5-18(19(14)31-32)35-22(28)29)11-7-16(26)15(17(27)8-11)10-33-21(34)13-3-2-6-30-20(13)23(33,24)25/h2-9,22H,10H2,1H3 |
| InChIKey | NBANJTDJSFPVFR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.01 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|