C22H19FN4O3 — CID 166076446
6-[[2-fluoro-4-[3-methanimidoyl-4-(methylamino)phenyl]phenyl]methyl]-7,7-dihydroxypyrrolo[3,4-b]pyridin-5-one (PubChem CID 166076446) has the molecular formula C22H19FN4O3 and a molecular weight of 406.42 g/mol. Its IUPAC name is 6-[[2-fluoro-4-[3-methanimidoyl-4-(methylamino)phenyl]phenyl]methyl]-7,7-dihydroxypyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 6-[[2-fluoro-4-[3-methanimidoyl-4-(methylamino)phenyl]phenyl]methyl]-7,7-dihydroxypyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 166076446 |
| Molecular Formula | C22H19FN4O3 |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 6-[[2-fluoro-4-[3-methanimidoyl-4-(methylamino)phenyl]phenyl]methyl]-7,7-dihydroxypyrrolo[3,4-b]pyridin-5-one |
| SMILES | [H]/N=C/c1cc(-c2ccc(CN3C(=O)c4cccnc4C3(O)O)c(F)c2)ccc1NC |
| InChI | InChI=1S/C22H19FN4O3/c1-25-19-7-6-13(9-16(19)11-24)14-4-5-15(18(23)10-14)12-27-21(28)17-3-2-8-26-20(17)22(27,29)30/h2-11,24-25,29-30H,12H2,1H3/b24-11+ |
| InChIKey | DRGYOTOWIYDGNG-BHGWPJFGSA-N |
| XLogP | 2.68 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|