C21H16BClFN5O2 — CID 166076484
CID 166076484 (PubChem CID 166076484) has the molecular formula C21H16BClFN5O2 and a molecular weight of 435.66 g/mol.
| Compound Name | CID 166076484 |
|---|---|
| PubChem CID | 166076484 |
| Molecular Formula | C21H16BClFN5O2 |
| Molecular Weight | 435.66 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | — |
| SMILES | [B]C1(O)c2ncccc2C(=O)N1Cc1c(F)cc(-c2cnc(N)c(/C=N/C)c2)cc1Cl |
| InChI | InChI=1S/C21H16BClFN5O2/c1-26-8-13-5-12(9-28-19(13)25)11-6-16(23)15(17(24)7-11)10-29-20(30)14-3-2-4-27-18(14)21(29,22)31/h2-9,31H,10H2,1H3,(H2,25,28)/b26-8+ |
| InChIKey | ZWZUAQKJTHKUSS-MWRNPHMMSA-N |
| XLogP | 2.49 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.66 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|