C21H16BF2N5O2 — CID 166076579
6-[2-amino-3-(methyliminomethyl)-4-pyridinyl]-4,9-difluoro-10-hydroxy-1,12-diaza-9-boratetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,11(16),12,14-hexaen-17-one (PubChem CID 166076579) has the molecular formula C21H16BF2N5O2 and a molecular weight of 419.20 g/mol. Its IUPAC name is 6-[2-amino-3-(methyliminomethyl)-4-pyridinyl]-4,9-difluoro-10-hydroxy-1,12-diaza-9-boratetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,11(16),12,14-hexaen-17-one.
| Compound Name | 6-[2-amino-3-(methyliminomethyl)-4-pyridinyl]-4,9-difluoro-10-hydroxy-1,12-diaza-9-boratetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,11(16),12,14-hexaen-17-one |
|---|---|
| PubChem CID | 166076579 |
| Molecular Formula | C21H16BF2N5O2 |
| Molecular Weight | 419.20 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 6-[2-amino-3-(methyliminomethyl)-4-pyridinyl]-4,9-difluoro-10-hydroxy-1,12-diaza-9-boratetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,11(16),12,14-hexaen-17-one |
| SMILES | C/N=C/c1c(-c2cc(F)c3c(c2)B(F)C2(O)c4ncccc4C(=O)N2C3)ccnc1N |
| InChI | InChI=1S/C21H16BF2N5O2/c1-26-9-14-12(4-6-28-19(14)25)11-7-16-15(17(23)8-11)10-29-20(30)13-3-2-5-27-18(13)21(29,31)22(16)24/h2-9,31H,10H2,1H3,(H2,25,28)/b26-9+ |
| InChIKey | HNKBYRZVKLATTE-JQAMDZJQSA-N |
| XLogP | 1.44 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.20 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|