C23H19BF2N4O2 — CID 166076824
6-[3-amino-4-methyl-2-(methyliminomethyl)phenyl]-4,9-difluoro-10-hydroxy-1,12-diaza-9-boratetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,11(16),12,14-hexaen-17-one (PubChem CID 166076824) has the molecular formula C23H19BF2N4O2 and a molecular weight of 432.24 g/mol. Its IUPAC name is 6-[3-amino-4-methyl-2-(methyliminomethyl)phenyl]-4,9-difluoro-10-hydroxy-1,12-diaza-9-boratetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,11(16),12,14-hexaen-17-one.
| Compound Name | 6-[3-amino-4-methyl-2-(methyliminomethyl)phenyl]-4,9-difluoro-10-hydroxy-1,12-diaza-9-boratetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,11(16),12,14-hexaen-17-one |
|---|---|
| PubChem CID | 166076824 |
| Molecular Formula | C23H19BF2N4O2 |
| Molecular Weight | 432.24 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 6-[3-amino-4-methyl-2-(methyliminomethyl)phenyl]-4,9-difluoro-10-hydroxy-1,12-diaza-9-boratetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,11(16),12,14-hexaen-17-one |
| SMILES | C/N=C/c1c(-c2cc(F)c3c(c2)B(F)C2(O)c4ncccc4C(=O)N2C3)ccc(C)c1N |
| InChI | InChI=1S/C23H19BF2N4O2/c1-12-5-6-14(16(10-28-2)20(12)27)13-8-18-17(19(25)9-13)11-30-22(31)15-4-3-7-29-21(15)23(30,32)24(18)26/h3-10,32H,11,27H2,1-2H3/b28-10+ |
| InChIKey | GHLPOCHRXAMUGC-ORBVJSQLSA-N |
| XLogP | 2.35 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|