C23H24FN5O3 — CID 166076779
2-[[[4-[2-amino-3-(methyliminomethyl)-4-pyridinyl]-2-fluoro-6-methylphenyl]methyl-methylamino]-dihydroxymethyl]pyridine-3-carbaldehyde (PubChem CID 166076779) has the molecular formula C23H24FN5O3 and a molecular weight of 437.48 g/mol. Its IUPAC name is 2-[[[4-[2-amino-3-(methyliminomethyl)-4-pyridinyl]-2-fluoro-6-methylphenyl]methyl-methylamino]-dihydroxymethyl]pyridine-3-carbaldehyde.
| Compound Name | 2-[[[4-[2-amino-3-(methyliminomethyl)-4-pyridinyl]-2-fluoro-6-methylphenyl]methyl-methylamino]-dihydroxymethyl]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 166076779 |
| Molecular Formula | C23H24FN5O3 |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 2-[[[4-[2-amino-3-(methyliminomethyl)-4-pyridinyl]-2-fluoro-6-methylphenyl]methyl-methylamino]-dihydroxymethyl]pyridine-3-carbaldehyde |
| SMILES | C/N=C/c1c(-c2cc(C)c(CN(C)C(O)(O)c3ncccc3C=O)c(F)c2)ccnc1N |
| InChI | InChI=1S/C23H24FN5O3/c1-14-9-16(17-6-8-28-22(25)18(17)11-26-2)10-20(24)19(14)12-29(3)23(31,32)21-15(13-30)5-4-7-27-21/h4-11,13,31-32H,12H2,1-3H3,(H2,25,28)/b26-11+ |
| InChIKey | RJRBDPHIGAQTFV-KBKYJPHKSA-N |
| XLogP | 2.26 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|