C25H25B2FN4O2 — CID 171528060
CID 171528060 (PubChem CID 171528060) has the molecular formula C25H25B2FN4O2 and a molecular weight of 454.12 g/mol.
| Compound Name | CID 171528060 |
|---|---|
| PubChem CID | 171528060 |
| Molecular Formula | C25H25B2FN4O2 |
| Molecular Weight | 454.12 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)c1ccc(-c2cc(C)c(CN(C)Cc3ncccc3C=O)c(F)c2)c(/C=N/C)c1N |
| InChI | InChI=1S/C25H25B2FN4O2/c1-15-9-17(18-6-7-21(25(26,27)34)24(29)19(18)11-30-2)10-22(28)20(15)12-32(3)13-23-16(14-33)5-4-8-31-23/h4-11,14,34H,12-13,29H2,1-3H3/b30-11+ |
| InChIKey | GXZXPOHZWTXCKY-KNBZMSCYSA-N |
| XLogP | 2.71 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.12 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|