C25H27FN4O3 — CID 166076560
2-[[[4-[3-amino-4-methyl-2-(methyliminomethyl)phenyl]-2-fluoro-6-methylphenyl]methyl-methylamino]-dihydroxymethyl]pyridine-3-carbaldehyde (PubChem CID 166076560) has the molecular formula C25H27FN4O3 and a molecular weight of 450.51 g/mol. Its IUPAC name is 2-[[[4-[3-amino-4-methyl-2-(methyliminomethyl)phenyl]-2-fluoro-6-methylphenyl]methyl-methylamino]-dihydroxymethyl]pyridine-3-carbaldehyde.
| Compound Name | 2-[[[4-[3-amino-4-methyl-2-(methyliminomethyl)phenyl]-2-fluoro-6-methylphenyl]methyl-methylamino]-dihydroxymethyl]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 166076560 |
| Molecular Formula | C25H27FN4O3 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 2-[[[4-[3-amino-4-methyl-2-(methyliminomethyl)phenyl]-2-fluoro-6-methylphenyl]methyl-methylamino]-dihydroxymethyl]pyridine-3-carbaldehyde |
| SMILES | C/N=C/c1c(-c2cc(C)c(CN(C)C(O)(O)c3ncccc3C=O)c(F)c2)ccc(C)c1N |
| InChI | InChI=1S/C25H27FN4O3/c1-15-7-8-19(20(12-28-3)23(15)27)18-10-16(2)21(22(26)11-18)13-30(4)25(32,33)24-17(14-31)6-5-9-29-24/h5-12,14,32-33H,13,27H2,1-4H3/b28-12+ |
| InChIKey | WVMPCUZUNBBJSF-KVSWJAHQSA-N |
| XLogP | 3.17 |
| TPSA | 112.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|