C49H97N3O2S2 — CID 166078364
(Z)-1-[[(Z)-2-hydroxyoctadec-9-enyl]-[4-[2-(4-propylpiperazin-1-yl)ethyldisulfanyl]butyl]amino]octadec-9-en-2-ol (PubChem CID 166078364) has the molecular formula C49H97N3O2S2 and a molecular weight of 824.47 g/mol. Its IUPAC name is (Z)-1-[[(Z)-2-hydroxyoctadec-9-enyl]-[4-[2-(4-propylpiperazin-1-yl)ethyldisulfanyl]butyl]amino]octadec-9-en-2-ol.
| Compound Name | (Z)-1-[[(Z)-2-hydroxyoctadec-9-enyl]-[4-[2-(4-propylpiperazin-1-yl)ethyldisulfanyl]butyl]amino]octadec-9-en-2-ol |
|---|---|
| PubChem CID | 166078364 |
| Molecular Formula | C49H97N3O2S2 |
| Molecular Weight | 824.47 g/mol |
| Exact Mass | 823.70 |
| IUPAC Name | (Z)-1-[[(Z)-2-hydroxyoctadec-9-enyl]-[4-[2-(4-propylpiperazin-1-yl)ethyldisulfanyl]butyl]amino]octadec-9-en-2-ol |
| SMILES | CCCCCCCC/C=C\CCCCCCC(O)CN(CCCCSSCCN1CCN(CCC)CC1)CC(O)CCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C49H97N3O2S2/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-35-48(53)46-52(38-33-34-44-55-56-45-43-51-41-39-50(37-6-3)40-42-51)47-49(54)36-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2/h19-22,48-49,53-54H,4-18,23-47H2,1-3H3/b21-19-,22-20- |
| InChIKey | QIUHBXNABOWRBH-WRBBJXAJSA-N |
| XLogP | 13.49 |
| TPSA | 50.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.47 |
| LogP ≤ 5 | 13.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|