C23H19N3O3S — CID 16607868
[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] (E)-3-quinolin-8-ylprop-2-enoate (PubChem CID 16607868) has the molecular formula C23H19N3O3S and a molecular weight of 417.49 g/mol. Its IUPAC name is [2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] (E)-3-quinolin-8-ylprop-2-enoate.
| Compound Name | [2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] (E)-3-quinolin-8-ylprop-2-enoate |
|---|---|
| PubChem CID | 16607868 |
| Molecular Formula | C23H19N3O3S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | [2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl] (E)-3-quinolin-8-ylprop-2-enoate |
| SMILES | N#Cc1c(NC(=O)COC(=O)/C=C/c2cccc3cccnc23)sc2c1CCCC2 |
| InChI | InChI=1S/C23H19N3O3S/c24-13-18-17-8-1-2-9-19(17)30-23(18)26-20(27)14-29-21(28)11-10-16-6-3-5-15-7-4-12-25-22(15)16/h3-7,10-12H,1-2,8-9,14H2,(H,26,27)/b11-10+ |
| InChIKey | CMHDVQHCWIICCZ-ZHACJKMWSA-N |
| XLogP | 4.24 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|