C31H39F3N6OS — CID 166078808
2-[3-[cyclobutyl-[3-[[5-[[(3R)-3-methyl-4-sulfanylpiperidin-1-yl]methyl]-3-(trifluoromethyl)-2-pyridinyl]methylamino]phenyl]methyl]-4-methylpyrazol-1-yl]acetamide (PubChem CID 166078808) has the molecular formula C31H39F3N6OS and a molecular weight of 600.76 g/mol. Its IUPAC name is 2-[3-[cyclobutyl-[3-[[5-[[(3R)-3-methyl-4-sulfanylpiperidin-1-yl]methyl]-3-(trifluoromethyl)-2-pyridinyl]methylamino]phenyl]methyl]-4-methylpyrazol-1-yl]acetamide.
| Compound Name | 2-[3-[cyclobutyl-[3-[[5-[[(3R)-3-methyl-4-sulfanylpiperidin-1-yl]methyl]-3-(trifluoromethyl)-2-pyridinyl]methylamino]phenyl]methyl]-4-methylpyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 166078808 |
| Molecular Formula | C31H39F3N6OS |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | 2-[3-[cyclobutyl-[3-[[5-[[(3R)-3-methyl-4-sulfanylpiperidin-1-yl]methyl]-3-(trifluoromethyl)-2-pyridinyl]methylamino]phenyl]methyl]-4-methylpyrazol-1-yl]acetamide |
| SMILES | Cc1cn(CC(N)=O)nc1C(c1cccc(NCc2ncc(CN3CCC(S)[C@H](C)C3)cc2C(F)(F)F)c1)C1CCC1 |
| InChI | InChI=1S/C31H39F3N6OS/c1-19-15-39(10-9-27(19)42)17-21-11-25(31(32,33)34)26(37-13-21)14-36-24-8-4-7-23(12-24)29(22-5-3-6-22)30-20(2)16-40(38-30)18-28(35)41/h4,7-8,11-13,16,19,22,27,29,36,42H,3,5-6,9-10,14-15,17-18H2,1-2H3,(H2,35,41)/t19-,27?,29?/m1/s1 |
| InChIKey | URAMLCRNSLQDQG-JITVNWOXSA-N |
| XLogP | 5.77 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|