C29H32F3N5OS — CID 174023401
2-[3-[cyclobutyl(1,3,4-thiadiazol-2-yl)methyl]phenyl]-6-[[(3S,4R)-3,4-dimethylpiperidin-1-yl]methyl]-8-(trifluoromethyl)imidazo[1,5-a]pyridin-3-one (PubChem CID 174023401) has the molecular formula C29H32F3N5OS and a molecular weight of 555.67 g/mol. Its IUPAC name is 2-[3-[cyclobutyl(1,3,4-thiadiazol-2-yl)methyl]phenyl]-6-[[(3S,4R)-3,4-dimethylpiperidin-1-yl]methyl]-8-(trifluoromethyl)imidazo[1,5-a]pyridin-3-one.
| Compound Name | 2-[3-[cyclobutyl(1,3,4-thiadiazol-2-yl)methyl]phenyl]-6-[[(3S,4R)-3,4-dimethylpiperidin-1-yl]methyl]-8-(trifluoromethyl)imidazo[1,5-a]pyridin-3-one |
|---|---|
| PubChem CID | 174023401 |
| Molecular Formula | C29H32F3N5OS |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | 2-[3-[cyclobutyl(1,3,4-thiadiazol-2-yl)methyl]phenyl]-6-[[(3S,4R)-3,4-dimethylpiperidin-1-yl]methyl]-8-(trifluoromethyl)imidazo[1,5-a]pyridin-3-one |
| SMILES | C[C@@H]1CCN(Cc2cc(C(F)(F)F)c3cn(-c4cccc(C(c5nncs5)C5CCC5)c4)c(=O)n3c2)C[C@H]1C |
| InChI | InChI=1S/C29H32F3N5OS/c1-18-9-10-35(13-19(18)2)14-20-11-24(29(30,31)32)25-16-36(28(38)37(25)15-20)23-8-4-7-22(12-23)26(21-5-3-6-21)27-34-33-17-39-27/h4,7-8,11-12,15-19,21,26H,3,5-6,9-10,13-14H2,1-2H3/t18-,19-,26?/m1/s1 |
| InChIKey | XCPNJWOIBOGHNP-KWRYHXHMSA-N |
| XLogP | 6.37 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |