C35H44F3N4O — CID 178155775
CID 178155775 (PubChem CID 178155775) has the molecular formula C35H44F3N4O and a molecular weight of 593.76 g/mol.
| Compound Name | CID 178155775 |
|---|---|
| PubChem CID | 178155775 |
| Molecular Formula | C35H44F3N4O |
| Molecular Weight | 593.76 g/mol |
| Exact Mass | 593.35 |
| IUPAC Name | — |
| SMILES | CC.CCC1=N[C]([C@@H](c2cccc(-n3cc4c(C(F)(F)F)cc(CN5CCC[C@H](C)C5)cn4c3=O)c2)C2CCC2)C(C)=C1 |
| InChI | InChI=1S/C33H38F3N4O.C2H6/c1-4-26-14-22(3)31(37-26)30(24-9-5-10-24)25-11-6-12-27(16-25)39-20-29-28(33(34,35)36)15-23(19-40(29)32(39)41)18-38-13-7-8-21(2)17-38;1-2/h6,11-12,14-16,19-21,24,30H,4-5,7-10,13,17-18H2,1-3H3;1-2H3/t21-,30+;/m0./s1 |
| InChIKey | QJKMIWOHCQBRQW-JBGRJTRNSA-N |
| XLogP | 8.59 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.76 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |