C27H30F4N6O+ — CID 166080332
CID 166080332 (PubChem CID 166080332) has the molecular formula C27H30F4N6O+ and a molecular weight of 530.57 g/mol.
| Compound Name | CID 166080332 |
|---|---|
| PubChem CID | 166080332 |
| Molecular Formula | C27H30F4N6O+ |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | — |
| SMILES | C[N+]1=CN=N[C]1[C@@H](c1cccc(-n2cc3c(C(F)(F)F)cc(CN4CCCC4)cn3c2=O)c1)C1CCC1.F |
| InChI | InChI=1S/C27H29F3N6O.FH/c1-33-17-31-32-25(33)24(19-6-4-7-19)20-8-5-9-21(13-20)35-16-23-22(27(28,29)30)12-18(15-36(23)26(35)37)14-34-10-2-3-11-34;/h5,8-9,12-13,15-17,19,24H,2-4,6-7,10-11,14H2,1H3;1H/q+1;/t24-;/m1./s1 |
| InChIKey | OSSTXHFMCIDNCV-GJFSDDNBSA-N |
| XLogP | 5.37 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|