C28H29F5N6O — CID 166080412
2-[3-[(R)-cyclobutyl-(4-methyl-1,2,4-triazol-3-yl)methyl]phenyl]-6-[(3,3-difluoropiperidin-1-yl)methyl]-8-(trifluoromethyl)imidazo[1,5-a]pyridin-3-one (PubChem CID 166080412) has the molecular formula C28H29F5N6O and a molecular weight of 560.57 g/mol. Its IUPAC name is 2-[3-[(R)-cyclobutyl-(4-methyl-1,2,4-triazol-3-yl)methyl]phenyl]-6-[(3,3-difluoropiperidin-1-yl)methyl]-8-(trifluoromethyl)imidazo[1,5-a]pyridin-3-one.
| Compound Name | 2-[3-[(R)-cyclobutyl-(4-methyl-1,2,4-triazol-3-yl)methyl]phenyl]-6-[(3,3-difluoropiperidin-1-yl)methyl]-8-(trifluoromethyl)imidazo[1,5-a]pyridin-3-one |
|---|---|
| PubChem CID | 166080412 |
| Molecular Formula | C28H29F5N6O |
| Molecular Weight | 560.57 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | 2-[3-[(R)-cyclobutyl-(4-methyl-1,2,4-triazol-3-yl)methyl]phenyl]-6-[(3,3-difluoropiperidin-1-yl)methyl]-8-(trifluoromethyl)imidazo[1,5-a]pyridin-3-one |
| SMILES | Cn1cnnc1[C@@H](c1cccc(-n2cc3c(C(F)(F)F)cc(CN4CCCC(F)(F)C4)cn3c2=O)c1)C1CCC1 |
| InChI | InChI=1S/C28H29F5N6O/c1-36-17-34-35-25(36)24(19-5-2-6-19)20-7-3-8-21(12-20)38-15-23-22(28(31,32)33)11-18(14-39(23)26(38)40)13-37-10-4-9-27(29,30)16-37/h3,7-8,11-12,14-15,17,19,24H,2,4-6,9-10,13,16H2,1H3/t24-/m1/s1 |
| InChIKey | TYRRSEKEWFVYSC-XMMPIXPASA-N |
| XLogP | 5.40 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |