C28H30F3N6OSi — CID 166080354
CID 166080354 (PubChem CID 166080354) has the molecular formula C28H30F3N6OSi and a molecular weight of 551.67 g/mol.
| Compound Name | CID 166080354 |
|---|---|
| PubChem CID | 166080354 |
| Molecular Formula | C28H30F3N6OSi |
| Molecular Weight | 551.67 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | — |
| SMILES | Cn1cnnc1C(c1cccc(-n2cc3c(C(F)(F)F)cc(CN4CCC[C@@]4(C)[Si])cn3c2=O)c1)C1CCC1 |
| InChI | InChI=1S/C28H30F3N6OSi/c1-27(39)10-5-11-35(27)14-18-12-22(28(29,30)31)23-16-36(26(38)37(23)15-18)21-9-4-8-20(13-21)24(19-6-3-7-19)25-33-32-17-34(25)2/h4,8-9,12-13,15-17,19,24H,3,5-7,10-11,14H2,1-2H3/t24?,27-/m1/s1 |
| InChIKey | RUJRQWJVJVHALS-LFHRXCRSSA-N |
| XLogP | 4.65 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.67 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|