C58H64F6N12O4+2 — CID 166079773
CID 166079773 (PubChem CID 166079773) has the molecular formula C58H64F6N12O4+2 and a molecular weight of 1107.22 g/mol.
| Compound Name | CID 166079773 |
|---|---|
| PubChem CID | 166079773 |
| Molecular Formula | C58H64F6N12O4+2 |
| Molecular Weight | 1107.22 g/mol |
| Exact Mass | 1106.51 |
| IUPAC Name | — |
| SMILES | CC.C[C@H]1CCCN(Cc2cc(C(F)(F)F)c3cn(-c4cccc(C([C]5N=NC=[N+]5C)=C5CCC5)c4)c(=O)n3c2)C1.C[N+]1=CN=N[C]1[C@@H](c1cccc(-n2cc3c(C(F)(F)F)cc(CN4CCCOC4=O)cn3c2=O)c1)C1CCC1 |
| InChI | InChI=1S/C29H31F3N6O.C27H27F3N6O3.C2H6/c1-19-6-5-11-36(14-19)15-20-12-24(29(30,31)32)25-17-37(28(39)38(25)16-20)23-10-4-9-22(13-23)26(21-7-3-8-21)27-34-33-18-35(27)2;1-33-16-31-32-24(33)23(18-5-2-6-18)19-7-3-8-20(12-19)35-15-22-21(27(28,29)30)11-17(14-36(22)25(35)37)13-34-9-4-10-39-26(34)38;1-2/h4,9-10,12-13,16-19H,3,5-8,11,14-15H2,1-2H3;3,7-8,11-12,14-16,18,23H,2,4-6,9-10,13H2,1H3;1-2H3/q2*+1;/t19-;23-;/m01./s1 |
| InChIKey | BSSHARJLTOKJLC-HKRJWQKKSA-N |
| XLogP | 11.89 |
| TPSA | 141.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1107.22 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|