About CID 178155764
CID 178155764 (PubChem CID 178155764) has the molecular formula C31H35F3N5O2
and a molecular weight of 566.65 g/mol.
Molecular Properties
| Compound Name | CID 178155764 |
| PubChem CID | 178155764 |
| Molecular Formula | C31H35F3N5O2 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | — |
| SMILES | COCC1CC([C@@H]([C]2C=CN=N2)c2cccc(-n3cc4c(C(F)(F)F)cc(CN5CCC[C@H](C)C5)cn4c3=O)c2)C1 |
| InChI | InChI=1S/C31H35F3N5O2/c1-20-5-4-10-37(15-20)16-22-13-26(31(32,33)34)28-18-38(30(40)39(28)17-22)25-7-3-6-23(14-25)29(27-8-9-35-36-27)24-11-21(12-24)19-41-2/h3,6-9,13-14,17-18,20-21,24,29H,4-5,10-12,15-16,19H2,1-2H3/t20-,21?,24?,29-/m0/s1 |
| InChIKey | QBLKMNHZLWHPAH-QSAOUZBWSA-N |
| XLogP | 6.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 178155764 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178155764?
The IUPAC name of CID 178155764 (CID 178155764) is not available.
What is the SMILES notation for CID 178155764?
The canonical SMILES for CID 178155764 is COCC1CC([C@@H]([C]2C=CN=N2)c2cccc(-n3cc4c(C(F)(F)F)cc(CN5CCC[C@H](C)C5)cn4c3=O)c2)C1.
What is the InChIKey of CID 178155764?
The InChIKey is QBLKMNHZLWHPAH-QSAOUZBWSA-N. The full InChI is InChI=1S/C31H35F3N5O2/c1-20-5-4-10-37(15-20)16-22-13-26(31(32,33)34)28-18-38(30(40)39(28)17-22)25-7-3-6-23(14-25)29(27-8-9-35-36-27)24-11-21(12-24)19-41-2/h3,6-9,13-14,17-18,20-21,24,29H,4-5,10-12,15-16,19H2,1-2H3/t20-,21?,24?,29-/m0/s1.
What are the key properties of CID 178155764?
CID 178155764 has a molecular weight of 566.65 g/mol, XLogP of 6.61, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178155764 is sourced from PubChem (CID 178155764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).