C31H35F3N5O2 — CID 178155764
CID 178155764 (PubChem CID 178155764) has the molecular formula C31H35F3N5O2 and a molecular weight of 566.65 g/mol.
| Compound Name | CID 178155764 |
|---|---|
| PubChem CID | 178155764 |
| Molecular Formula | C31H35F3N5O2 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | — |
| SMILES | COCC1CC([C@@H]([C]2C=CN=N2)c2cccc(-n3cc4c(C(F)(F)F)cc(CN5CCC[C@H](C)C5)cn4c3=O)c2)C1 |
| InChI | InChI=1S/C31H35F3N5O2/c1-20-5-4-10-37(15-20)16-22-13-26(31(32,33)34)28-18-38(30(40)39(28)17-22)25-7-3-6-23(14-25)29(27-8-9-35-36-27)24-11-21(12-24)19-41-2/h3,6-9,13-14,17-18,20-21,24,29H,4-5,10-12,15-16,19H2,1-2H3/t20-,21?,24?,29-/m0/s1 |
| InChIKey | QBLKMNHZLWHPAH-QSAOUZBWSA-N |
| XLogP | 6.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |