C23H29N5O — CID 166079846
3-[(1Z)-buta-1,3-dienyl]-1-[(3E)-4-[2-cyclobutyl-1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexa-1,3,5-trien-2-yl]-4-methylimidazol-2-one (PubChem CID 166079846) has the molecular formula C23H29N5O and a molecular weight of 391.52 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-1-[(3E)-4-[2-cyclobutyl-1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexa-1,3,5-trien-2-yl]-4-methylimidazol-2-one.
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-1-[(3E)-4-[2-cyclobutyl-1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexa-1,3,5-trien-2-yl]-4-methylimidazol-2-one |
|---|---|
| PubChem CID | 166079846 |
| Molecular Formula | C23H29N5O |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-1-[(3E)-4-[2-cyclobutyl-1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexa-1,3,5-trien-2-yl]-4-methylimidazol-2-one |
| SMILES | C=C/C=C\n1c(C)cn(C(=C)/C=C(\C=C)C(CC2CCC2)c2nncn2C)c1=O |
| InChI | InChI=1S/C23H29N5O/c1-6-8-12-27-18(4)15-28(23(27)29)17(3)13-20(7-2)21(14-19-10-9-11-19)22-25-24-16-26(22)5/h6-8,12-13,15-16,19,21H,1-3,9-11,14H2,4-5H3/b12-8-,20-13+ |
| InChIKey | YFYWNQQIPNYBEW-WQESZTHLSA-N |
| XLogP | 4.30 |
| TPSA | 57.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|