C15H22N4 — CID 166080004
(3E)-4-[2-cyclobutyl-1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexa-1,3,5-trien-2-amine (PubChem CID 166080004) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is (3E)-4-[2-cyclobutyl-1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexa-1,3,5-trien-2-amine.
| Compound Name | (3E)-4-[2-cyclobutyl-1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 166080004 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (3E)-4-[2-cyclobutyl-1-(4-methyl-1,2,4-triazol-3-yl)ethyl]hexa-1,3,5-trien-2-amine |
| SMILES | C=C/C(=C\C(=C)N)C(CC1CCC1)c1nncn1C |
| InChI | InChI=1S/C15H22N4/c1-4-13(8-11(2)16)14(9-12-6-5-7-12)15-18-17-10-19(15)3/h4,8,10,12,14H,1-2,5-7,9,16H2,3H3/b13-8+ |
| InChIKey | LNNNIESJQRFYLE-MDWZMJQESA-N |
| XLogP | 2.67 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|