C17H24F4N2 — CID 166080108
5-[(4-fluoropiperidin-1-yl)methyl]-2-pentan-3-yl-3-(trifluoromethyl)pyridine (PubChem CID 166080108) has the molecular formula C17H24F4N2 and a molecular weight of 332.39 g/mol. Its IUPAC name is 5-[(4-fluoropiperidin-1-yl)methyl]-2-pentan-3-yl-3-(trifluoromethyl)pyridine.
| Compound Name | 5-[(4-fluoropiperidin-1-yl)methyl]-2-pentan-3-yl-3-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 166080108 |
| Molecular Formula | C17H24F4N2 |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 5-[(4-fluoropiperidin-1-yl)methyl]-2-pentan-3-yl-3-(trifluoromethyl)pyridine |
| SMILES | CCC(CC)c1ncc(CN2CCC(F)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C17H24F4N2/c1-3-13(4-2)16-15(17(19,20)21)9-12(10-22-16)11-23-7-5-14(18)6-8-23/h9-10,13-14H,3-8,11H2,1-2H3 |
| InChIKey | CNPBNQLOACRDPW-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |