C27H27F3N6O2+ — CID 166080397
CID 166080397 (PubChem CID 166080397) has the molecular formula C27H27F3N6O2+ and a molecular weight of 524.55 g/mol.
| Compound Name | CID 166080397 |
|---|---|
| PubChem CID | 166080397 |
| Molecular Formula | C27H27F3N6O2+ |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | — |
| SMILES | CN1CC=C(c2cc(C(F)(F)F)c3cn(-c4cccc(C5(C[C]6N=NC=[N+]6C)COC5)c4)c(=O)n3c2)CC1 |
| InChI | InChI=1S/C27H27F3N6O2/c1-33-8-6-18(7-9-33)19-10-22(27(28,29)30)23-14-35(25(37)36(23)13-19)21-5-3-4-20(11-21)26(15-38-16-26)12-24-32-31-17-34(24)2/h3-6,10-11,13-14,17H,7-9,12,15-16H2,1-2H3/q+1 |
| InChIKey | BSIVJIGQVYJKKZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|