C27H28FN7O2 — CID 166080970
1-[3-[6-cyclopropyl-4-(2-fluoro-4-methylanilino)-1,3-dimethyl-2,5-dioxopyrido[2,3-d]pyridazin-8-yl]phenyl]-2-methylguanidine (PubChem CID 166080970) has the molecular formula C27H28FN7O2 and a molecular weight of 501.57 g/mol. Its IUPAC name is 1-[3-[6-cyclopropyl-4-(2-fluoro-4-methylanilino)-1,3-dimethyl-2,5-dioxopyrido[2,3-d]pyridazin-8-yl]phenyl]-2-methylguanidine.
| Compound Name | 1-[3-[6-cyclopropyl-4-(2-fluoro-4-methylanilino)-1,3-dimethyl-2,5-dioxopyrido[2,3-d]pyridazin-8-yl]phenyl]-2-methylguanidine |
|---|---|
| PubChem CID | 166080970 |
| Molecular Formula | C27H28FN7O2 |
| Molecular Weight | 501.57 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | 1-[3-[6-cyclopropyl-4-(2-fluoro-4-methylanilino)-1,3-dimethyl-2,5-dioxopyrido[2,3-d]pyridazin-8-yl]phenyl]-2-methylguanidine |
| SMILES | C/N=C(\N)Nc1cccc(-c2nn(C3CC3)c(=O)c3c(Nc4ccc(C)cc4F)c(C)c(=O)n(C)c23)c1 |
| InChI | InChI=1S/C27H28FN7O2/c1-14-8-11-20(19(28)12-14)32-22-15(2)25(36)34(4)24-21(22)26(37)35(18-9-10-18)33-23(24)16-6-5-7-17(13-16)31-27(29)30-3/h5-8,11-13,18,32H,9-10H2,1-4H3,(H3,29,30,31) |
| InChIKey | FSRGVTGGVKTLHO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|