C24H21FN4O3 — CID 166080921
8-(3-aminophenyl)-6-cyclopropyl-4-(2-fluoro-4-methylanilino)-3-methylpyrano[2,3-d]pyridazine-2,5-dione (PubChem CID 166080921) has the molecular formula C24H21FN4O3 and a molecular weight of 432.46 g/mol. Its IUPAC name is 8-(3-aminophenyl)-6-cyclopropyl-4-(2-fluoro-4-methylanilino)-3-methylpyrano[2,3-d]pyridazine-2,5-dione.
| Compound Name | 8-(3-aminophenyl)-6-cyclopropyl-4-(2-fluoro-4-methylanilino)-3-methylpyrano[2,3-d]pyridazine-2,5-dione |
|---|---|
| PubChem CID | 166080921 |
| Molecular Formula | C24H21FN4O3 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 8-(3-aminophenyl)-6-cyclopropyl-4-(2-fluoro-4-methylanilino)-3-methylpyrano[2,3-d]pyridazine-2,5-dione |
| SMILES | Cc1ccc(Nc2c(C)c(=O)oc3c(-c4cccc(N)c4)nn(C4CC4)c(=O)c23)c(F)c1 |
| InChI | InChI=1S/C24H21FN4O3/c1-12-6-9-18(17(25)10-12)27-20-13(2)24(31)32-22-19(20)23(30)29(16-7-8-16)28-21(22)14-4-3-5-15(26)11-14/h3-6,9-11,16,27H,7-8,26H2,1-2H3 |
| InChIKey | LRPNUZUHBDGTQI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 103.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|