C21H16ClF2N5O3S — CID 166081752
N-[3-[(6-chloropyrido[3,2-d]pyrimidin-4-yl)amino]-2,4-difluorophenyl]-4-methoxy-2-methylbenzenesulfonamide (PubChem CID 166081752) has the molecular formula C21H16ClF2N5O3S and a molecular weight of 491.91 g/mol. Its IUPAC name is N-[3-[(6-chloropyrido[3,2-d]pyrimidin-4-yl)amino]-2,4-difluorophenyl]-4-methoxy-2-methylbenzenesulfonamide.
| Compound Name | N-[3-[(6-chloropyrido[3,2-d]pyrimidin-4-yl)amino]-2,4-difluorophenyl]-4-methoxy-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 166081752 |
| Molecular Formula | C21H16ClF2N5O3S |
| Molecular Weight | 491.91 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | N-[3-[(6-chloropyrido[3,2-d]pyrimidin-4-yl)amino]-2,4-difluorophenyl]-4-methoxy-2-methylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(F)c(Nc3ncnc4ccc(Cl)nc34)c2F)c(C)c1 |
| InChI | InChI=1S/C21H16ClF2N5O3S/c1-11-9-12(32-2)3-7-16(11)33(30,31)29-14-5-4-13(23)19(18(14)24)28-21-20-15(25-10-26-21)6-8-17(22)27-20/h3-10,29H,1-2H3,(H,25,26,28) |
| InChIKey | HSWBNMOOFJUQKB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.91 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|