C23H19N3O4 — CID 16608234
[1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl] (E)-3-quinolin-8-ylprop-2-enoate (PubChem CID 16608234) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is [1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl] (E)-3-quinolin-8-ylprop-2-enoate.
| Compound Name | [1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl] (E)-3-quinolin-8-ylprop-2-enoate |
|---|---|
| PubChem CID | 16608234 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | [1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl] (E)-3-quinolin-8-ylprop-2-enoate |
| SMILES | CC(OC(=O)/C=C/c1cccc2cccnc12)C(=O)N1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C23H19N3O4/c1-15(23(29)26-14-20(27)25-18-9-2-3-10-19(18)26)30-21(28)12-11-17-7-4-6-16-8-5-13-24-22(16)17/h2-13,15H,14H2,1H3,(H,25,27)/b12-11+ |
| InChIKey | IAMXLEAYKZVBLH-VAWYXSNFSA-N |
| XLogP | 3.16 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|