C38H28BrCl2N — CID 166084567
7-(3-bromo-2,5-dichlorophenyl)-5,10-bis(2,6-dimethylphenyl)benzo[c]carbazole (PubChem CID 166084567) has the molecular formula C38H28BrCl2N and a molecular weight of 649.46 g/mol. Its IUPAC name is 7-(3-bromo-2,5-dichlorophenyl)-5,10-bis(2,6-dimethylphenyl)benzo[c]carbazole.
| Compound Name | 7-(3-bromo-2,5-dichlorophenyl)-5,10-bis(2,6-dimethylphenyl)benzo[c]carbazole |
|---|---|
| PubChem CID | 166084567 |
| Molecular Formula | C38H28BrCl2N |
| Molecular Weight | 649.46 g/mol |
| Exact Mass | 647.08 |
| IUPAC Name | 7-(3-bromo-2,5-dichlorophenyl)-5,10-bis(2,6-dimethylphenyl)benzo[c]carbazole |
| SMILES | Cc1cccc(C)c1-c1ccc2c(c1)c1c3ccccc3c(-c3c(C)cccc3C)cc1n2-c1cc(Cl)cc(Br)c1Cl |
| InChI | InChI=1S/C38H28BrCl2N/c1-21-9-7-10-22(2)35(21)25-15-16-32-30(17-25)37-28-14-6-5-13-27(28)29(36-23(3)11-8-12-24(36)4)20-33(37)42(32)34-19-26(40)18-31(39)38(34)41/h5-20H,1-4H3 |
| InChIKey | XZRMETKXMBBHPE-UHFFFAOYSA-N |
| XLogP | 12.57 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.46 |
| LogP ≤ 5 | 12.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|