C26H26Cl2FN — CID 166084575
3,6-ditert-butyl-1-(2,5-dichloro-3-fluorophenyl)-9H-carbazole (PubChem CID 166084575) has the molecular formula C26H26Cl2FN and a molecular weight of 442.41 g/mol. Its IUPAC name is 3,6-ditert-butyl-1-(2,5-dichloro-3-fluorophenyl)-9H-carbazole.
| Compound Name | 3,6-ditert-butyl-1-(2,5-dichloro-3-fluorophenyl)-9H-carbazole |
|---|---|
| PubChem CID | 166084575 |
| Molecular Formula | C26H26Cl2FN |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 3,6-ditert-butyl-1-(2,5-dichloro-3-fluorophenyl)-9H-carbazole |
| SMILES | CC(C)(C)c1ccc2[nH]c3c(-c4cc(Cl)cc(F)c4Cl)cc(C(C)(C)C)cc3c2c1 |
| InChI | InChI=1S/C26H26Cl2FN/c1-25(2,3)14-7-8-22-17(9-14)19-10-15(26(4,5)6)11-20(24(19)30-22)18-12-16(27)13-21(29)23(18)28/h7-13,30H,1-6H3 |
| InChIKey | COVIVJKYNNWPEG-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|