C47H52BN2 — CID 171749653
CID 171749653 (PubChem CID 171749653) has the molecular formula C47H52BN2 and a molecular weight of 655.76 g/mol.
| Compound Name | CID 171749653 |
|---|---|
| PubChem CID | 171749653 |
| Molecular Formula | C47H52BN2 |
| Molecular Weight | 655.76 g/mol |
| Exact Mass | 655.42 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(c1-c1cc(C(C)(C)C)cc3c1[nH]c1ccc(C(C)(C)C)cc13)[B]c1cc(C(C)(C)C)cc3c4cc(C(C)(C)C)ccc4n-2c13 |
| InChI | InChI=1S/C47H52BN2/c1-26-14-18-39-41(40(26)35-24-29(46(8,9)10)22-33-31-20-27(44(2,3)4)15-17-37(31)49-42(33)35)48-36-25-30(47(11,12)13)23-34-32-21-28(45(5,6)7)16-19-38(32)50(39)43(34)36/h14-25,49H,1-13H3 |
| InChIKey | LEWDFSXBHJONMS-UHFFFAOYSA-N |
| XLogP | 11.55 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.76 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|