C70H76BN2 — CID 174133334
CID 174133334 (PubChem CID 174133334) has the molecular formula C70H76BN2 and a molecular weight of 956.20 g/mol.
| Compound Name | CID 174133334 |
|---|---|
| PubChem CID | 174133334 |
| Molecular Formula | C70H76BN2 |
| Molecular Weight | 956.20 g/mol |
| Exact Mass | 955.61 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(N2C3=C([B]c4c2cc2c(c4-c4cc(C(C)(C)C)cc5c4[nH]c4ccc(C(C)(C)C)cc45)-c4ccccc4C2(C)C)C(C)(C)c2cc4c(cc23)C(C)(C)CCC4(C)C)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C70H76BN2/c1-64(2,3)41-27-29-55-46(34-41)47-35-43(66(7,8)9)36-49(61(47)72-55)59-58-44-25-21-22-26-50(44)69(14,15)54(58)39-57-60(59)71-63-62(48-37-52-53(38-51(48)70(63,16)17)68(12,13)32-31-67(52,10)11)73(57)56-30-28-42(65(4,5)6)33-45(56)40-23-19-18-20-24-40/h18-30,33-39,72H,31-32H2,1-17H3 |
| InChIKey | YJJCOXPTLLUBAA-UHFFFAOYSA-N |
| XLogP | 18.34 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 956.20 |
| LogP ≤ 5 | 18.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|