C61H52BN2OS — CID 174133481
CID 174133481 (PubChem CID 174133481) has the molecular formula C61H52BN2OS and a molecular weight of 871.98 g/mol.
| Compound Name | CID 174133481 |
|---|---|
| PubChem CID | 174133481 |
| Molecular Formula | C61H52BN2OS |
| Molecular Weight | 871.98 g/mol |
| Exact Mass | 871.39 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(Nc2ccc3c(c2-c2c4c(cc5c2oc2ccccc25)N(c2ccc(C(C)(C)C)cc2-c2ccccc2)c2c(sc5ccccc25)[B]4)-c2ccccc2C3(C)C)cc1 |
| InChI | InChI=1S/C61H52BN2OS/c1-59(2,3)37-26-29-39(30-27-37)63-47-32-31-46-52(41-21-12-15-23-45(41)61(46,7)8)53(47)54-55-49(35-44-40-20-13-16-24-50(40)65-57(44)54)64(56-42-22-14-17-25-51(42)66-58(56)62-55)48-33-28-38(60(4,5)6)34-43(48)36-18-10-9-11-19-36/h9-35,63H,1-8H3 |
| InChIKey | HYSMHPWQTWLOBL-UHFFFAOYSA-N |
| XLogP | 16.22 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.98 |
| LogP ≤ 5 | 16.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|