C59H52BN2O — CID 174126446
CID 174126446 (PubChem CID 174126446) has the molecular formula C59H52BN2O and a molecular weight of 815.89 g/mol.
| Compound Name | CID 174126446 |
|---|---|
| PubChem CID | 174126446 |
| Molecular Formula | C59H52BN2O |
| Molecular Weight | 815.89 g/mol |
| Exact Mass | 815.42 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(Nc2ccc3c(c2-c2cc4ccccc4c4c2[B]c2c(oc5ccccc25)N4c2ccc(C(C)(C)C)cc2-c2ccccc2)C(C)(C)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C59H52BN2O/c1-57(2,3)38-26-29-40(30-27-38)61-48-32-31-43-42-22-14-16-24-47(42)59(7,8)52(43)51(48)46-34-37-20-12-13-21-41(37)55-53(46)60-54-44-23-15-17-25-50(44)63-56(54)62(55)49-33-28-39(58(4,5)6)35-45(49)36-18-10-9-11-19-36/h9-35,61H,1-8H3 |
| InChIKey | MNJPXTDLKLFWOU-UHFFFAOYSA-N |
| XLogP | 15.00 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.89 |
| LogP ≤ 5 | 15.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|