C72H69BN3 — CID 174127363
CID 174127363 (PubChem CID 174127363) has the molecular formula C72H69BN3 and a molecular weight of 987.18 g/mol.
| Compound Name | CID 174127363 |
|---|---|
| PubChem CID | 174127363 |
| Molecular Formula | C72H69BN3 |
| Molecular Weight | 987.18 g/mol |
| Exact Mass | 986.56 |
| IUPAC Name | — |
| SMILES | Cc1cc(C(C)(C)C)ccc1N1c2cc(N(c3ccc(C(C)(C)C)cc3)c3ccc(C(C)(C)C)cc3)ccc2[B]c2c(-c3cc4ccccc4cc3Nc3ccc4c(c3)C(C)(C)c3ccccc3-4)cc3ccccc3c21 |
| InChI | InChI=1S/C72H69BN3/c1-45-39-51(71(8,9)10)29-38-65(45)76-66-44-55(75(53-31-25-49(26-32-53)69(2,3)4)54-33-27-50(28-34-54)70(5,6)7)35-37-63(66)73-67-60(41-48-21-15-16-22-56(48)68(67)76)59-40-46-19-13-14-20-47(46)42-64(59)74-52-30-36-58-57-23-17-18-24-61(57)72(11,12)62(58)43-52/h13-44,74H,1-12H3 |
| InChIKey | SHQNDHMCSHKSBV-UHFFFAOYSA-N |
| XLogP | 18.82 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 987.18 |
| LogP ≤ 5 | 18.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|