C65H55BN3O — CID 174127382
CID 174127382 (PubChem CID 174127382) has the molecular formula C65H55BN3O and a molecular weight of 904.99 g/mol.
| Compound Name | CID 174127382 |
|---|---|
| PubChem CID | 174127382 |
| Molecular Formula | C65H55BN3O |
| Molecular Weight | 904.99 g/mol |
| Exact Mass | 904.44 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(Nc2cc3c(cc2-c2c4c5c(c6cc(C(C)(C)C)ccc6n5-c5cc(N(c6ccccc6)c6ccccc6)ccc5[B]4)c4c2oc2ccccc24)-c2ccccc2C3(C)C)cc1 |
| InChI | InChI=1S/C65H55BN3O/c1-63(2,3)39-27-30-41(31-28-39)67-53-38-51-47(45-23-15-17-25-50(45)65(51,7)8)37-48(53)59-60-61-57(58-46-24-16-18-26-56(46)70-62(58)59)49-35-40(64(4,5)6)29-34-54(49)69(61)55-36-44(32-33-52(55)66-60)68(42-19-11-9-12-20-42)43-21-13-10-14-22-43/h9-38,67H,1-8H3 |
| InChIKey | YFWMDQBCQSNKCE-UHFFFAOYSA-N |
| XLogP | 16.43 |
| TPSA | 33.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.99 |
| LogP ≤ 5 | 16.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|