C70H71BN3OS — CID 174121533
CID 174121533 (PubChem CID 174121533) has the molecular formula C70H71BN3OS and a molecular weight of 1013.24 g/mol.
| Compound Name | CID 174121533 |
|---|---|
| PubChem CID | 174121533 |
| Molecular Formula | C70H71BN3OS |
| Molecular Weight | 1013.24 g/mol |
| Exact Mass | 1012.54 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(Nc2cc(N(c3ccc(C(C)(C)C)cc3)c3ccc(C(C)(C)C)cc3)ccc2-c2c3c4c(c5cc(C(C)(C)C)ccc5n4-c4c(sc5ccc(C(C)(C)C)cc45)[B]3)c3oc4ccccc4c23)cc1 |
| InChI | InChI=1S/C70H71BN3OS/c1-66(2,3)41-20-28-46(29-21-41)72-54-40-49(73(47-30-22-42(23-31-47)67(4,5)6)48-32-24-43(25-33-48)68(7,8)9)34-35-50(54)58-59-51-18-16-17-19-56(51)75-64(59)60-52-38-44(69(10,11)12)26-36-55(52)74-62-53-39-45(70(13,14)15)27-37-57(53)76-65(62)71-61(58)63(60)74/h16-40,72H,1-15H3 |
| InChIKey | FRPBBTBKMRVPQV-UHFFFAOYSA-N |
| XLogP | 19.23 |
| TPSA | 33.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1013.24 |
| LogP ≤ 5 | 19.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|