C61H60BN2O — CID 174127377
CID 174127377 (PubChem CID 174127377) has the molecular formula C61H60BN2O and a molecular weight of 847.98 g/mol.
| Compound Name | CID 174127377 |
|---|---|
| PubChem CID | 174127377 |
| Molecular Formula | C61H60BN2O |
| Molecular Weight | 847.98 g/mol |
| Exact Mass | 847.48 |
| IUPAC Name | — |
| SMILES | Cc1cc(C(C)(C)C)ccc1N1c2cc3oc4cc5c(cc4c3cc2[B]c2c(-c3ccc4ccccc4c3Nc3ccc(C(C)(C)C)cc3)cc3ccccc3c21)C(C)(C)CCC5(C)C |
| InChI | InChI=1S/C61H60BN2O/c1-36-30-40(59(5,6)7)23-27-51(36)64-52-35-54-46(45-32-48-49(34-53(45)65-54)61(10,11)29-28-60(48,8)9)33-50(52)62-55-47(31-38-17-13-15-19-43(38)57(55)64)44-26-20-37-16-12-14-18-42(37)56(44)63-41-24-21-39(22-25-41)58(2,3)4/h12-27,30-35,63H,28-29H2,1-11H3 |
| InChIKey | HCKKIRIBZMNBPR-UHFFFAOYSA-N |
| XLogP | 15.99 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.98 |
| LogP ≤ 5 | 15.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|