C60H60BN2S — CID 174018047
CID 174018047 (PubChem CID 174018047) has the molecular formula C60H60BN2S and a molecular weight of 852.03 g/mol.
| Compound Name | CID 174018047 |
|---|---|
| PubChem CID | 174018047 |
| Molecular Formula | C60H60BN2S |
| Molecular Weight | 852.03 g/mol |
| Exact Mass | 851.46 |
| IUPAC Name | — |
| SMILES | Cc1cc(-c2ccc3ccccc3c2Nc2ccc(-c3ccccc3)cc2)c2c(c1)N(c1cc3c(cc1C)C(C)(C)CCC3(C)C)c1c(sc3cc4c(cc13)C(C)(C)CCC4(C)C)[B]2 |
| InChI | InChI=1S/C60H60BN2S/c1-36-30-44(43-25-22-40-18-14-15-19-42(40)54(43)62-41-23-20-39(21-24-41)38-16-12-11-13-17-38)53-51(31-36)63(50-34-48-46(32-37(50)2)57(3,4)26-28-59(48,7)8)55-45-33-47-49(35-52(45)64-56(55)61-53)60(9,10)29-27-58(47,5)6/h11-25,30-35,62H,26-29H2,1-10H3 |
| InChIKey | HEXNSLGOMFEXJL-UHFFFAOYSA-N |
| XLogP | 15.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.03 |
| LogP ≤ 5 | 15.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|