About CID 174018042
CID 174018042 (PubChem CID 174018042) has the molecular formula C60H58BN2OS
and a molecular weight of 866.02 g/mol.
Molecular Properties
| Compound Name | CID 174018042 |
| PubChem CID | 174018042 |
| Molecular Formula | C60H58BN2OS |
| Molecular Weight | 866.02 g/mol |
| Exact Mass | 865.44 |
| IUPAC Name | — |
| SMILES | Cc1cc(-c2c(Nc3cccc4sc5ccccc5c34)ccc3ccccc23)c2c(c1)N(c1cc3c(cc1C)C(C)(C)CCC3(C)C)c1c(oc3cc4c(cc13)C(C)(C)CCC4(C)C)[B]2 |
| InChI | InChI=1S/C60H58BN2OS/c1-34-28-40(52-37-17-12-11-16-36(37)22-23-46(52)62-45-19-15-21-51-53(45)38-18-13-14-20-50(38)65-51)54-48(29-34)63(47-32-43-41(30-35(47)2)57(3,4)24-26-59(43,7)8)55-39-31-42-44(33-49(39)64-56(55)61-54)60(9,10)27-25-58(42,5)6/h11-23,28-33,62H,24-27H2,1-10H3 |
| InChIKey | PUASTLOXEZOZJS-UHFFFAOYSA-N |
| XLogP | 16.12 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 65 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 866.02 |
| LogP ≤ 5 | 16.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174018042 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174018042?
The IUPAC name of CID 174018042 (CID 174018042) is not available.
What is the SMILES notation for CID 174018042?
The canonical SMILES for CID 174018042 is Cc1cc(-c2c(Nc3cccc4sc5ccccc5c34)ccc3ccccc23)c2c(c1)N(c1cc3c(cc1C)C(C)(C)CCC3(C)C)c1c(oc3cc4c(cc13)C(C)(C)CCC4(C)C)[B]2.
What is the InChIKey of CID 174018042?
The InChIKey is PUASTLOXEZOZJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C60H58BN2OS/c1-34-28-40(52-37-17-12-11-16-36(37)22-23-46(52)62-45-19-15-21-51-53(45)38-18-13-14-20-50(38)65-51)54-48(29-34)63(47-32-43-41(30-35(47)2)57(3,4)24-26-59(43,7)8)55-39-31-42-44(33-49(39)64-56(55)61-54)60(9,10)27-25-58(42,5)6/h11-23,28-33,62H,24-27H2,1-10H3.
What are the key properties of CID 174018042?
CID 174018042 has a molecular weight of 866.02 g/mol, XLogP of 16.12, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174018042 is sourced from PubChem (CID 174018042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).