C65H58BN2O2S — CID 174018267
CID 174018267 (PubChem CID 174018267) has the molecular formula C65H58BN2O2S and a molecular weight of 942.07 g/mol.
| Compound Name | CID 174018267 |
|---|---|
| PubChem CID | 174018267 |
| Molecular Formula | C65H58BN2O2S |
| Molecular Weight | 942.07 g/mol |
| Exact Mass | 941.43 |
| IUPAC Name | — |
| SMILES | Cc1cc2c(cc1N1c3c(oc4cc5c(cc34)C(C)(C)CCC5(C)C)[B]c3c(-c4c(Nc5cccc6sc7ccccc7c56)ccc5ccccc45)cc4c(oc5ccccc54)c31)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C65H58BN2O2S/c1-36-31-44-46(64(6,7)29-27-62(44,2)3)34-50(36)68-58-42-33-45-47(65(8,9)30-28-63(45,4)5)35-52(42)70-61(58)66-57-43(32-41-39-19-12-14-22-51(39)69-60(41)59(57)68)55-38-18-11-10-17-37(38)25-26-49(55)67-48-21-16-24-54-56(48)40-20-13-15-23-53(40)71-54/h10-26,31-35,67H,27-30H2,1-9H3 |
| InChIKey | GPUXJOZXLULWQS-UHFFFAOYSA-N |
| XLogP | 17.71 |
| TPSA | 41.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.07 |
| LogP ≤ 5 | 17.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|