C44H38BN2O2 — CID 174017766
CID 174017766 (PubChem CID 174017766) has the molecular formula C44H38BN2O2 and a molecular weight of 637.61 g/mol.
| Compound Name | CID 174017766 |
|---|---|
| PubChem CID | 174017766 |
| Molecular Formula | C44H38BN2O2 |
| Molecular Weight | 637.61 g/mol |
| Exact Mass | 637.30 |
| IUPAC Name | — |
| SMILES | Cc1cc(-c2cccc3c2[nH]c2c4ccccc4oc32)c2c(c1)N(c1cc3c(cc1C)C(C)(C)CCC3(C)C)c1c(oc3ccccc13)[B]2 |
| InChI | InChI=1S/C44H38BN2O2/c1-24-20-30(26-14-11-15-29-38(26)46-39-27-12-7-9-16-35(27)48-41(29)39)37-34(21-24)47(40-28-13-8-10-17-36(28)49-42(40)45-37)33-23-32-31(22-25(33)2)43(3,4)18-19-44(32,5)6/h7-17,20-23,46H,18-19H2,1-6H3 |
| InChIKey | TZYITYNBSCMFRE-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 45.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.61 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|