C54H58BN2Si — CID 174017433
CID 174017433 (PubChem CID 174017433) has the molecular formula C54H58BN2Si and a molecular weight of 773.97 g/mol.
| Compound Name | CID 174017433 |
|---|---|
| PubChem CID | 174017433 |
| Molecular Formula | C54H58BN2Si |
| Molecular Weight | 773.97 g/mol |
| Exact Mass | 773.45 |
| IUPAC Name | — |
| SMILES | Cc1cc(-c2cccc3c2Nc2ccccc2[Si]3(C)C)c2c(c1)N(c1cc3c(cc1C)C(C)(C)CCC3(C)C)c1cc3c(cc1[B]2)C(C)(C)c1ccccc1C3(C)C |
| InChI | InChI=1S/C54H58BN2Si/c1-32-26-35(34-18-17-23-48-50(34)56-43-21-15-16-22-47(43)58(48,11)12)49-46(27-32)57(44-30-39-38(28-33(44)2)51(3,4)24-25-52(39,5)6)45-31-41-40(29-42(45)55-49)53(7,8)36-19-13-14-20-37(36)54(41,9)10/h13-23,26-31,56H,24-25H2,1-12H3 |
| InChIKey | ZVLGMGICWIELSA-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.97 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|