C38H26BN2O — CID 174018263
CID 174018263 (PubChem CID 174018263) has the molecular formula C38H26BN2O and a molecular weight of 537.45 g/mol.
| Compound Name | CID 174018263 |
|---|---|
| PubChem CID | 174018263 |
| Molecular Formula | C38H26BN2O |
| Molecular Weight | 537.45 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | — |
| SMILES | Cc1cc(-c2cccc3c2[nH]c2c4ccccc4oc32)c2c(c1)-n1c3c(c4cccc(c41)[B]2)-c1ccccc1C3(C)C |
| InChI | InChI=1S/C38H26BN2O/c1-20-18-26(21-12-8-14-25-33(21)40-34-23-11-5-7-17-30(23)42-36(25)34)32-29(19-20)41-35-24(13-9-16-28(35)39-32)31-22-10-4-6-15-27(22)38(2,3)37(31)41/h4-19,40H,1-3H3 |
| InChIKey | LQBZVROJMPMMKU-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 33.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.45 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|