C67H56BN2O2S — CID 174015799
CID 174015799 (PubChem CID 174015799) has the molecular formula C67H56BN2O2S and a molecular weight of 964.08 g/mol.
| Compound Name | CID 174015799 |
|---|---|
| PubChem CID | 174015799 |
| Molecular Formula | C67H56BN2O2S |
| Molecular Weight | 964.08 g/mol |
| Exact Mass | 963.42 |
| IUPAC Name | — |
| SMILES | Cc1ccc(Nc2ccc3c(c2-c2c4c(cc5c2oc2ccccc25)N(c2cc5c(cc2C)C(C)(C)CCC5(C)C)c2cc5c(cc2[B]4)Oc2ccccc2S5)-c2ccccc2C3(C)C)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C67H56BN2O2S/c1-38-26-28-50(43(32-38)40-18-10-9-11-19-40)69-51-29-27-46-60(42-21-12-14-22-45(42)67(46,7)8)61(51)62-63-54(34-44-41-20-13-15-23-55(41)72-64(44)62)70(52-35-48-47(33-39(52)2)65(3,4)30-31-66(48,5)6)53-37-59-57(36-49(53)68-63)71-56-24-16-17-25-58(56)73-59/h9-29,32-37,69H,30-31H2,1-8H3 |
| InChIKey | LZBUZPDJSNEBMC-UHFFFAOYSA-N |
| XLogP | 17.63 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 964.08 |
| LogP ≤ 5 | 17.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|