C83H87BN3OS — CID 174133697
CID 174133697 (PubChem CID 174133697) has the molecular formula C83H87BN3OS and a molecular weight of 1185.51 g/mol.
| Compound Name | CID 174133697 |
|---|---|
| PubChem CID | 174133697 |
| Molecular Formula | C83H87BN3OS |
| Molecular Weight | 1185.51 g/mol |
| Exact Mass | 1184.67 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(Nc2cc3c(cc2-c2c4c(cc5c2oc2ccccc25)N(c2ccc(C(C)(C)C)cc2)c2c(sc5cc6c(cc25)C(C)(C)CCC6(C)C)[B]4)-c2cc(N(c4ccc(C(C)(C)C)cc4)c4ccc(C(C)(C)C)cc4)ccc2C3(C)C)cc1 |
| InChI | InChI=1S/C83H87BN3OS/c1-77(2,3)49-23-31-53(32-24-49)85-68-47-65-60(59-43-57(39-40-64(59)83(65,17)18)86(54-33-25-50(26-34-54)78(4,5)6)55-35-27-51(28-36-55)79(7,8)9)44-62(68)72-73-69(46-61-58-21-19-20-22-70(58)88-75(61)72)87(56-37-29-52(30-38-56)80(10,11)12)74-63-45-66-67(48-71(63)89-76(74)84-73)82(15,16)42-41-81(66,13)14/h19-40,43-48,85H,41-42H2,1-18H3 |
| InChIKey | BZOBVORJSCEVSU-UHFFFAOYSA-N |
| XLogP | 22.96 |
| TPSA | 31.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 89 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1185.51 |
| LogP ≤ 5 | 22.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|